C11H10N4O2 — CID 135950880
N-(3-hydroxy-2-pyridinyl)-5-methylpyrazine-2-carboxamide (PubChem CID 135950880) has the molecular formula C11H10N4O2 and a molecular weight of 230.23 g/mol. Its IUPAC name is N-(3-hydroxy-2-pyridinyl)-5-methylpyrazine-2-carboxamide.
| Compound Name | N-(3-hydroxy-2-pyridinyl)-5-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 135950880 |
| Molecular Formula | C11H10N4O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | N-(3-hydroxy-2-pyridinyl)-5-methylpyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)Nc2ncccc2O)cn1 |
| InChI | InChI=1S/C11H10N4O2/c1-7-5-14-8(6-13-7)11(17)15-10-9(16)3-2-4-12-10/h2-6,16H,1H3,(H,12,15,17) |
| InChIKey | BLVRVCFFGDUBNZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |