C12H11F2N3OS — CID 47321455
N-[2-(difluoromethylsulfanyl)phenyl]-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 47321455) has the molecular formula C12H11F2N3OS and a molecular weight of 283.30 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 47321455 |
| Molecular Formula | C12H11F2N3OS |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccccc2SC(F)F)n[nH]1 |
| InChI | InChI=1S/C12H11F2N3OS/c1-7-6-9(17-16-7)11(18)15-8-4-2-3-5-10(8)19-12(13)14/h2-6,12H,1H3,(H,15,18)(H,16,17) |
| InChIKey | PXDJEAZUDCTJIA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |