C7H12N4O — CID 13405307
N,N',5-trimethyl-1H-pyrazole-3-carbohydrazide (PubChem CID 13405307) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is N,N',5-trimethyl-1H-pyrazole-3-carbohydrazide.
| Compound Name | N,N',5-trimethyl-1H-pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 13405307 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | N,N',5-trimethyl-1H-pyrazole-3-carbohydrazide |
| SMILES | CNN(C)C(=O)c1cc(C)[nH]n1 |
| InChI | InChI=1S/C7H12N4O/c1-5-4-6(10-9-5)7(12)11(3)8-2/h4,8H,1-3H3,(H,9,10) |
| InChIKey | PNJXPXXSPPKCCI-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|