C20H21BrCl2N2O2S — CID 17343583
5-bromo-N-[(2,4-dichlorophenyl)carbamothioyl]-2-hexoxybenzamide (PubChem CID 17343583) has the molecular formula C20H21BrCl2N2O2S and a molecular weight of 504.28 g/mol. Its IUPAC name is 5-bromo-N-[(2,4-dichlorophenyl)carbamothioyl]-2-hexoxybenzamide.
| Compound Name | 5-bromo-N-[(2,4-dichlorophenyl)carbamothioyl]-2-hexoxybenzamide |
|---|---|
| PubChem CID | 17343583 |
| Molecular Formula | C20H21BrCl2N2O2S |
| Molecular Weight | 504.28 g/mol |
| Exact Mass | 501.99 |
| IUPAC Name | 5-bromo-N-[(2,4-dichlorophenyl)carbamothioyl]-2-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H21BrCl2N2O2S/c1-2-3-4-5-10-27-18-9-6-13(21)11-15(18)19(26)25-20(28)24-17-8-7-14(22)12-16(17)23/h6-9,11-12H,2-5,10H2,1H3,(H2,24,25,26,28) |
| InChIKey | ZNNOHKZYFOGLFT-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.28 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|