C16H12Cl2F4N2S — CID 3773281
1-[(2,4-dichlorophenyl)methyl]-3-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]thiourea (PubChem CID 3773281) has the molecular formula C16H12Cl2F4N2S and a molecular weight of 411.25 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]thiourea.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 3773281 |
| Molecular Formula | C16H12Cl2F4N2S |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]thiourea |
| SMILES | Fc1c(CNC(=S)NCc2ccc(Cl)cc2Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C16H12Cl2F4N2S/c17-11-5-4-9(13(18)6-11)7-23-15(25)24-8-10-2-1-3-12(14(10)19)16(20,21)22/h1-6H,7-8H2,(H2,23,24,25) |
| InChIKey | FRPJSKKEYFWZBE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|