C10H11F2N3OS — CID 142092209
1-[(2,3-difluorophenyl)methyl]-3-(2-nitrosoethyl)thiourea (PubChem CID 142092209) has the molecular formula C10H11F2N3OS and a molecular weight of 259.28 g/mol. Its IUPAC name is 1-[(2,3-difluorophenyl)methyl]-3-(2-nitrosoethyl)thiourea.
| Compound Name | 1-[(2,3-difluorophenyl)methyl]-3-(2-nitrosoethyl)thiourea |
|---|---|
| PubChem CID | 142092209 |
| Molecular Formula | C10H11F2N3OS |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 1-[(2,3-difluorophenyl)methyl]-3-(2-nitrosoethyl)thiourea |
| SMILES | O=NCCNC(=S)NCc1cccc(F)c1F |
| InChI | InChI=1S/C10H11F2N3OS/c11-8-3-1-2-7(9(8)12)6-14-10(17)13-4-5-15-16/h1-3H,4-6H2,(H2,13,14,17) |
| InChIKey | SKQKNFABIHXPOU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|