C15H12ClO3- — CID 4614539
3-(5-chloro-2-hydroxyphenyl)-3-phenylpropanoate (PubChem CID 4614539) has the molecular formula C15H12ClO3- and a molecular weight of 275.71 g/mol. Its IUPAC name is 3-(5-chloro-2-hydroxyphenyl)-3-phenylpropanoate.
| Compound Name | 3-(5-chloro-2-hydroxyphenyl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 4614539 |
| Molecular Formula | C15H12ClO3- |
| Molecular Weight | 275.71 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 3-(5-chloro-2-hydroxyphenyl)-3-phenylpropanoate |
| SMILES | O=C([O-])CC(c1ccccc1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C15H13ClO3/c16-11-6-7-14(17)13(8-11)12(9-15(18)19)10-4-2-1-3-5-10/h1-8,12,17H,9H2,(H,18,19)/p-1 |
| InChIKey | MXZMXRGCRQAVJR-UHFFFAOYSA-M |
| XLogP | 2.32 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.71 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |