C19H22ClNO3 — CID 974812
(3R)-3-(5-chloro-2-hydroxyphenyl)-N-ethyl-N-(2-hydroxyethyl)-3-phenylpropanamide (PubChem CID 974812) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is (3R)-3-(5-chloro-2-hydroxyphenyl)-N-ethyl-N-(2-hydroxyethyl)-3-phenylpropanamide.
| Compound Name | (3R)-3-(5-chloro-2-hydroxyphenyl)-N-ethyl-N-(2-hydroxyethyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 974812 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (3R)-3-(5-chloro-2-hydroxyphenyl)-N-ethyl-N-(2-hydroxyethyl)-3-phenylpropanamide |
| SMILES | CCN(CCO)C(=O)C[C@H](c1ccccc1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C19H22ClNO3/c1-2-21(10-11-22)19(24)13-16(14-6-4-3-5-7-14)17-12-15(20)8-9-18(17)23/h3-9,12,16,22-23H,2,10-11,13H2,1H3/t16-/m1/s1 |
| InChIKey | XSVAJXUWLGSBIN-MRXNPFEDSA-N |
| XLogP | 3.41 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |