C21H28BrClNO+ — CID 163771935
1-bromoethyl-[(3R)-3-(5-chloro-2-hydroxyphenyl)-3-phenylpropyl]-methyl-propan-2-ylazanium (PubChem CID 163771935) has the molecular formula C21H28BrClNO+ and a molecular weight of 425.82 g/mol. Its IUPAC name is 1-bromoethyl-[(3R)-3-(5-chloro-2-hydroxyphenyl)-3-phenylpropyl]-methyl-propan-2-ylazanium.
| Compound Name | 1-bromoethyl-[(3R)-3-(5-chloro-2-hydroxyphenyl)-3-phenylpropyl]-methyl-propan-2-ylazanium |
|---|---|
| PubChem CID | 163771935 |
| Molecular Formula | C21H28BrClNO+ |
| Molecular Weight | 425.82 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 1-bromoethyl-[(3R)-3-(5-chloro-2-hydroxyphenyl)-3-phenylpropyl]-methyl-propan-2-ylazanium |
| SMILES | CC(C)[N+](C)(CC[C@H](c1ccccc1)c1cc(Cl)ccc1O)C(C)Br |
| InChI | InChI=1S/C21H27BrClNO/c1-15(2)24(4,16(3)22)13-12-19(17-8-6-5-7-9-17)20-14-18(23)10-11-21(20)25/h5-11,14-16,19H,12-13H2,1-4H3/p+1/t16?,19-,24?/m1/s1 |
| InChIKey | MHEDVUYGMWKNEJ-HTQWRTEZSA-O |
| XLogP | 6.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.82 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|