C22H31BrNO+ — CID 10140902
[(3R)-3-(5-bromo-2-hydroxyphenyl)-3-phenylpropyl]-methyl-di(propan-2-yl)azanium (PubChem CID 10140902) has the molecular formula C22H31BrNO+ and a molecular weight of 405.40 g/mol. Its IUPAC name is [(3R)-3-(5-bromo-2-hydroxyphenyl)-3-phenylpropyl]-methyl-di(propan-2-yl)azanium.
| Compound Name | [(3R)-3-(5-bromo-2-hydroxyphenyl)-3-phenylpropyl]-methyl-di(propan-2-yl)azanium |
|---|---|
| PubChem CID | 10140902 |
| Molecular Formula | C22H31BrNO+ |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | [(3R)-3-(5-bromo-2-hydroxyphenyl)-3-phenylpropyl]-methyl-di(propan-2-yl)azanium |
| SMILES | CC(C)[N+](C)(CC[C@H](c1ccccc1)c1cc(Br)ccc1O)C(C)C |
| InChI | InChI=1S/C22H30BrNO/c1-16(2)24(5,17(3)4)14-13-20(18-9-7-6-8-10-18)21-15-19(23)11-12-22(21)25/h6-12,15-17,20H,13-14H2,1-5H3/p+1/t20-/m1/s1 |
| InChIKey | JPUXEIARZUXZRI-HXUWFJFHSA-O |
| XLogP | 5.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|