C23H31F3NO+ — CID 10116329
[(3R)-3-[2-hydroxy-5-(trifluoromethyl)phenyl]-3-phenylpropyl]-methyl-di(propan-2-yl)azanium (PubChem CID 10116329) has the molecular formula C23H31F3NO+ and a molecular weight of 394.50 g/mol. Its IUPAC name is [(3R)-3-[2-hydroxy-5-(trifluoromethyl)phenyl]-3-phenylpropyl]-methyl-di(propan-2-yl)azanium.
| Compound Name | [(3R)-3-[2-hydroxy-5-(trifluoromethyl)phenyl]-3-phenylpropyl]-methyl-di(propan-2-yl)azanium |
|---|---|
| PubChem CID | 10116329 |
| Molecular Formula | C23H31F3NO+ |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | [(3R)-3-[2-hydroxy-5-(trifluoromethyl)phenyl]-3-phenylpropyl]-methyl-di(propan-2-yl)azanium |
| SMILES | CC(C)[N+](C)(CC[C@H](c1ccccc1)c1cc(C(F)(F)F)ccc1O)C(C)C |
| InChI | InChI=1S/C23H30F3NO/c1-16(2)27(5,17(3)4)14-13-20(18-9-7-6-8-10-18)21-15-19(23(24,25)26)11-12-22(21)28/h6-12,15-17,20H,13-14H2,1-5H3/p+1/t20-/m1/s1 |
| InChIKey | VOBUJVUBSVASEE-HXUWFJFHSA-O |
| XLogP | 6.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|