C22H18F3NO2 — CID 166322824
N-[2-hydroxy-5-(trifluoromethyl)phenyl]-3,3-diphenylpropanamide (PubChem CID 166322824) has the molecular formula C22H18F3NO2 and a molecular weight of 385.39 g/mol. Its IUPAC name is N-[2-hydroxy-5-(trifluoromethyl)phenyl]-3,3-diphenylpropanamide.
| Compound Name | N-[2-hydroxy-5-(trifluoromethyl)phenyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 166322824 |
| Molecular Formula | C22H18F3NO2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-[2-hydroxy-5-(trifluoromethyl)phenyl]-3,3-diphenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)Nc1cc(C(F)(F)F)ccc1O |
| InChI | InChI=1S/C22H18F3NO2/c23-22(24,25)17-11-12-20(27)19(13-17)26-21(28)14-18(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,18,27H,14H2,(H,26,28) |
| InChIKey | ONLWJMNRVGTAAJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|