C17H26FN2O4S+ — CID 4148312
3-[(2-fluorophenyl)methylsulfonyl]-N-(3-morpholin-4-ium-4-ylpropyl)propanamide (PubChem CID 4148312) has the molecular formula C17H26FN2O4S+ and a molecular weight of 373.47 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methylsulfonyl]-N-(3-morpholin-4-ium-4-ylpropyl)propanamide.
| Compound Name | 3-[(2-fluorophenyl)methylsulfonyl]-N-(3-morpholin-4-ium-4-ylpropyl)propanamide |
|---|---|
| PubChem CID | 4148312 |
| Molecular Formula | C17H26FN2O4S+ |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 3-[(2-fluorophenyl)methylsulfonyl]-N-(3-morpholin-4-ium-4-ylpropyl)propanamide |
| SMILES | O=C(CCS(=O)(=O)Cc1ccccc1F)NCCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C17H25FN2O4S/c18-16-5-2-1-4-15(16)14-25(22,23)13-6-17(21)19-7-3-8-20-9-11-24-12-10-20/h1-2,4-5H,3,6-14H2,(H,19,21)/p+1 |
| InChIKey | FSZBIIIZBNESES-UHFFFAOYSA-O |
| XLogP | -0.45 |
| TPSA | 76.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|