C21H25NO3 — CID 45243515
N-cyclohexyl-3-(2-hydroxyphenyl)-3-(3-hydroxyphenyl)propanamide (PubChem CID 45243515) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-cyclohexyl-3-(2-hydroxyphenyl)-3-(3-hydroxyphenyl)propanamide.
| Compound Name | N-cyclohexyl-3-(2-hydroxyphenyl)-3-(3-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 45243515 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-cyclohexyl-3-(2-hydroxyphenyl)-3-(3-hydroxyphenyl)propanamide |
| SMILES | O=C(CC(c1cccc(O)c1)c1ccccc1O)NC1CCCCC1 |
| InChI | InChI=1S/C21H25NO3/c23-17-10-6-7-15(13-17)19(18-11-4-5-12-20(18)24)14-21(25)22-16-8-2-1-3-9-16/h4-7,10-13,16,19,23-24H,1-3,8-9,14H2,(H,22,25) |
| InChIKey | HIHBUXHTWXOKOO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |