C22H27NO3 — CID 45181483
1-(azocan-1-yl)-3-(2-hydroxyphenyl)-3-(3-hydroxyphenyl)propan-1-one (PubChem CID 45181483) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 1-(azocan-1-yl)-3-(2-hydroxyphenyl)-3-(3-hydroxyphenyl)propan-1-one.
| Compound Name | 1-(azocan-1-yl)-3-(2-hydroxyphenyl)-3-(3-hydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 45181483 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 1-(azocan-1-yl)-3-(2-hydroxyphenyl)-3-(3-hydroxyphenyl)propan-1-one |
| SMILES | O=C(CC(c1cccc(O)c1)c1ccccc1O)N1CCCCCCC1 |
| InChI | InChI=1S/C22H27NO3/c24-18-10-8-9-17(15-18)20(19-11-4-5-12-21(19)25)16-22(26)23-13-6-2-1-3-7-14-23/h4-5,8-12,15,20,24-25H,1-3,6-7,13-14,16H2 |
| InChIKey | VUEDIJLIJMLZDA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |