C21H31N2O3+ — CID 4594936
N-cyclohexyl-2-(1,4-dioxa-8-azoniaspiro[4.5]decan-8-yl)-2-phenylacetamide (PubChem CID 4594936) has the molecular formula C21H31N2O3+ and a molecular weight of 359.49 g/mol. Its IUPAC name is N-cyclohexyl-2-(1,4-dioxa-8-azoniaspiro[4.5]decan-8-yl)-2-phenylacetamide.
| Compound Name | N-cyclohexyl-2-(1,4-dioxa-8-azoniaspiro[4.5]decan-8-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 4594936 |
| Molecular Formula | C21H31N2O3+ |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | N-cyclohexyl-2-(1,4-dioxa-8-azoniaspiro[4.5]decan-8-yl)-2-phenylacetamide |
| SMILES | O=C(NC1CCCCC1)C(c1ccccc1)[NH+]1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C21H30N2O3/c24-20(22-18-9-5-2-6-10-18)19(17-7-3-1-4-8-17)23-13-11-21(12-14-23)25-15-16-26-21/h1,3-4,7-8,18-19H,2,5-6,9-16H2,(H,22,24)/p+1 |
| InChIKey | JKWIZPLNSDXSNA-UHFFFAOYSA-O |
| XLogP | 1.60 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |