C18H18Cl2N3O2+ — CID 2450954
(2S)-N-(3,5-dichlorophenyl)-2-(3-oxopiperazin-1-ium-1-yl)-2-phenylacetamide (PubChem CID 2450954) has the molecular formula C18H18Cl2N3O2+ and a molecular weight of 379.27 g/mol. Its IUPAC name is (2S)-N-(3,5-dichlorophenyl)-2-(3-oxopiperazin-1-ium-1-yl)-2-phenylacetamide.
| Compound Name | (2S)-N-(3,5-dichlorophenyl)-2-(3-oxopiperazin-1-ium-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 2450954 |
| Molecular Formula | C18H18Cl2N3O2+ |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (2S)-N-(3,5-dichlorophenyl)-2-(3-oxopiperazin-1-ium-1-yl)-2-phenylacetamide |
| SMILES | O=C1C[NH+]([C@H](C(=O)Nc2cc(Cl)cc(Cl)c2)c2ccccc2)CCN1 |
| InChI | InChI=1S/C18H17Cl2N3O2/c19-13-8-14(20)10-15(9-13)22-18(25)17(12-4-2-1-3-5-12)23-7-6-21-16(24)11-23/h1-5,8-10,17H,6-7,11H2,(H,21,24)(H,22,25)/p+1/t17-/m0/s1 |
| InChIKey | RCKYPJNKCMVVCI-KRWDZBQOSA-O |
| XLogP | 1.69 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |