C13H15Cl2N3O2 — CID 8516323
(2S)-N-(3,5-dichlorophenyl)-2-(3-oxopiperazin-1-yl)propanamide (PubChem CID 8516323) has the molecular formula C13H15Cl2N3O2 and a molecular weight of 316.19 g/mol. Its IUPAC name is (2S)-N-(3,5-dichlorophenyl)-2-(3-oxopiperazin-1-yl)propanamide.
| Compound Name | (2S)-N-(3,5-dichlorophenyl)-2-(3-oxopiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 8516323 |
| Molecular Formula | C13H15Cl2N3O2 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | (2S)-N-(3,5-dichlorophenyl)-2-(3-oxopiperazin-1-yl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1cc(Cl)cc(Cl)c1)N1CCNC(=O)C1 |
| InChI | InChI=1S/C13H15Cl2N3O2/c1-8(18-3-2-16-12(19)7-18)13(20)17-11-5-9(14)4-10(15)6-11/h4-6,8H,2-3,7H2,1H3,(H,16,19)(H,17,20)/t8-/m0/s1 |
| InChIKey | OTLRWRMZOJFQBH-QMMMGPOBSA-N |
| XLogP | 1.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |