C18H27F3N4O2+2 — CID 8774257
(2R)-2-[4-[2-oxo-2-(propylamino)ethyl]piperazine-1,4-diium-1-yl]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 8774257) has the molecular formula C18H27F3N4O2+2 and a molecular weight of 388.43 g/mol. Its IUPAC name is (2R)-2-[4-[2-oxo-2-(propylamino)ethyl]piperazine-1,4-diium-1-yl]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2R)-2-[4-[2-oxo-2-(propylamino)ethyl]piperazine-1,4-diium-1-yl]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 8774257 |
| Molecular Formula | C18H27F3N4O2+2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | (2R)-2-[4-[2-oxo-2-(propylamino)ethyl]piperazine-1,4-diium-1-yl]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | CCCNC(=O)C[NH+]1CC[NH+]([C@H](C)C(=O)Nc2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C18H25F3N4O2/c1-3-6-22-15(26)11-24-7-9-25(10-8-24)12(2)18(27)23-14-5-4-13(19)16(20)17(14)21/h4-5,12H,3,6-11H2,1-2H3,(H,22,26)(H,23,27)/p+2/t12-/m1/s1 |
| InChIKey | SPGVCRWORZRYFR-GFCCVEGCSA-P |
| XLogP | -1.26 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|