C20H33ClN4O3+2 — CID 8774385
(2R)-2-[4-[2-(butylamino)-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-(5-chloro-2-methoxyphenyl)propanamide (PubChem CID 8774385) has the molecular formula C20H33ClN4O3+2 and a molecular weight of 412.96 g/mol. Its IUPAC name is (2R)-2-[4-[2-(butylamino)-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-(5-chloro-2-methoxyphenyl)propanamide.
| Compound Name | (2R)-2-[4-[2-(butylamino)-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-(5-chloro-2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 8774385 |
| Molecular Formula | C20H33ClN4O3+2 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (2R)-2-[4-[2-(butylamino)-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-(5-chloro-2-methoxyphenyl)propanamide |
| SMILES | CCCCNC(=O)C[NH+]1CC[NH+]([C@H](C)C(=O)Nc2cc(Cl)ccc2OC)CC1 |
| InChI | InChI=1S/C20H31ClN4O3/c1-4-5-8-22-19(26)14-24-9-11-25(12-10-24)15(2)20(27)23-17-13-16(21)6-7-18(17)28-3/h6-7,13,15H,4-5,8-12,14H2,1-3H3,(H,22,26)(H,23,27)/p+2/t15-/m1/s1 |
| InChIKey | ZNHSEAOZFMVDJU-OAHLLOKOSA-P |
| XLogP | -0.62 |
| TPSA | 76.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|