C19H30ClFN4O2+2 — CID 8774379
(2S)-2-[4-[2-(butylamino)-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-(2-chloro-4-fluorophenyl)propanamide (PubChem CID 8774379) has the molecular formula C19H30ClFN4O2+2 and a molecular weight of 400.93 g/mol. Its IUPAC name is (2S)-2-[4-[2-(butylamino)-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-(2-chloro-4-fluorophenyl)propanamide.
| Compound Name | (2S)-2-[4-[2-(butylamino)-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-(2-chloro-4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 8774379 |
| Molecular Formula | C19H30ClFN4O2+2 |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (2S)-2-[4-[2-(butylamino)-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-(2-chloro-4-fluorophenyl)propanamide |
| SMILES | CCCCNC(=O)C[NH+]1CC[NH+]([C@@H](C)C(=O)Nc2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C19H28ClFN4O2/c1-3-4-7-22-18(26)13-24-8-10-25(11-9-24)14(2)19(27)23-17-6-5-15(21)12-16(17)20/h5-6,12,14H,3-4,7-11,13H2,1-2H3,(H,22,26)(H,23,27)/p+2/t14-/m0/s1 |
| InChIKey | DXQKGIWAMYHGIQ-AWEZNQCLSA-P |
| XLogP | -0.49 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|