C19H32N4O2+2 — CID 8774423
(2S)-2-[4-[2-(butylamino)-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-phenylpropanamide (PubChem CID 8774423) has the molecular formula C19H32N4O2+2 and a molecular weight of 348.49 g/mol. Its IUPAC name is (2S)-2-[4-[2-(butylamino)-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-phenylpropanamide.
| Compound Name | (2S)-2-[4-[2-(butylamino)-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 8774423 |
| Molecular Formula | C19H32N4O2+2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (2S)-2-[4-[2-(butylamino)-2-oxoethyl]piperazine-1,4-diium-1-yl]-N-phenylpropanamide |
| SMILES | CCCCNC(=O)C[NH+]1CC[NH+]([C@@H](C)C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C19H30N4O2/c1-3-4-10-20-18(24)15-22-11-13-23(14-12-22)16(2)19(25)21-17-8-6-5-7-9-17/h5-9,16H,3-4,10-15H2,1-2H3,(H,20,24)(H,21,25)/p+2/t16-/m0/s1 |
| InChIKey | NPORIUXFRAQVHC-INIZCTEOSA-P |
| XLogP | -1.29 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|