C17H26ClN2O+ — CID 2056160
(3R)-1-[(3-chlorophenyl)methyl]-N,N-diethylpiperidin-1-ium-3-carboxamide (PubChem CID 2056160) has the molecular formula C17H26ClN2O+ and a molecular weight of 309.86 g/mol. Its IUPAC name is (3R)-1-[(3-chlorophenyl)methyl]-N,N-diethylpiperidin-1-ium-3-carboxamide.
| Compound Name | (3R)-1-[(3-chlorophenyl)methyl]-N,N-diethylpiperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 2056160 |
| Molecular Formula | C17H26ClN2O+ |
| Molecular Weight | 309.86 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (3R)-1-[(3-chlorophenyl)methyl]-N,N-diethylpiperidin-1-ium-3-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1CCC[NH+](Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C17H25ClN2O/c1-3-20(4-2)17(21)15-8-6-10-19(13-15)12-14-7-5-9-16(18)11-14/h5,7,9,11,15H,3-4,6,8,10,12-13H2,1-2H3/p+1/t15-/m1/s1 |
| InChIKey | UPMSIIUPFDIZBD-OAHLLOKOSA-O |
| XLogP | 2.00 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.86 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |