C17H22ClNO3 — CID 120672699
4-[(3-chlorophenyl)methyl-ethylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120672699) has the molecular formula C17H22ClNO3 and a molecular weight of 323.82 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methyl-ethylcarbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3-chlorophenyl)methyl-ethylcarbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120672699 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 4-[(3-chlorophenyl)methyl-ethylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | CCN(Cc1cccc(Cl)c1)C(=O)C1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C17H22ClNO3/c1-2-19(11-12-4-3-5-15(18)10-12)16(20)13-6-8-14(9-7-13)17(21)22/h3-5,10,13-14H,2,6-9,11H2,1H3,(H,21,22) |
| InChIKey | QKGWWYQVFIQRAK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |