C16H23ClN2O — CID 64824765
2-amino-N-[(3-chlorophenyl)methyl]-N-ethylcyclohexane-1-carboxamide (PubChem CID 64824765) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is 2-amino-N-[(3-chlorophenyl)methyl]-N-ethylcyclohexane-1-carboxamide.
| Compound Name | 2-amino-N-[(3-chlorophenyl)methyl]-N-ethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 64824765 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-amino-N-[(3-chlorophenyl)methyl]-N-ethylcyclohexane-1-carboxamide |
| SMILES | CCN(Cc1cccc(Cl)c1)C(=O)C1CCCCC1N |
| InChI | InChI=1S/C16H23ClN2O/c1-2-19(11-12-6-5-7-13(17)10-12)16(20)14-8-3-4-9-15(14)18/h5-7,10,14-15H,2-4,8-9,11,18H2,1H3 |
| InChIKey | KGNRSNXGIVPTRN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |