C19H23F3N2O5 — CID 7894519
(3,3-dimethyl-2-oxobutyl) 1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylate (PubChem CID 7894519) has the molecular formula C19H23F3N2O5 and a molecular weight of 416.40 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7894519 |
| Molecular Formula | C19H23F3N2O5 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 1-[2-nitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxylate |
| SMILES | CC(C)(C)C(=O)COC(=O)C1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H23F3N2O5/c1-18(2,3)16(25)11-29-17(26)12-6-8-23(9-7-12)14-5-4-13(19(20,21)22)10-15(14)24(27)28/h4-5,10,12H,6-9,11H2,1-3H3 |
| InChIKey | QKLLBUMQCGLBGE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|