C17H16N4OS — CID 2573801
(2R)-1-(2-thiophen-2-ylquinazolin-4-yl)pyrrolidine-2-carboxamide (PubChem CID 2573801) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is (2R)-1-(2-thiophen-2-ylquinazolin-4-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(2-thiophen-2-ylquinazolin-4-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 2573801 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (2R)-1-(2-thiophen-2-ylquinazolin-4-yl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CCCN1c1nc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C17H16N4OS/c18-15(22)13-7-3-9-21(13)17-11-5-1-2-6-12(11)19-16(20-17)14-8-4-10-23-14/h1-2,4-6,8,10,13H,3,7,9H2,(H2,18,22)/t13-/m1/s1 |
| InChIKey | FBGPVHCGTGHAAI-CYBMUJFWSA-N |
| XLogP | 2.81 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |