C21H21N5S — CID 133280074
4-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]-2-thiophen-2-ylquinazoline (PubChem CID 133280074) has the molecular formula C21H21N5S and a molecular weight of 375.50 g/mol. Its IUPAC name is 4-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]-2-thiophen-2-ylquinazoline.
| Compound Name | 4-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]-2-thiophen-2-ylquinazoline |
|---|---|
| PubChem CID | 133280074 |
| Molecular Formula | C21H21N5S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 4-[4-(2-methylpyrazol-3-yl)piperidin-1-yl]-2-thiophen-2-ylquinazoline |
| SMILES | Cn1nccc1C1CCN(c2nc(-c3cccs3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C21H21N5S/c1-25-18(8-11-22-25)15-9-12-26(13-10-15)21-16-5-2-3-6-17(16)23-20(24-21)19-7-4-14-27-19/h2-8,11,14-15H,9-10,12-13H2,1H3 |
| InChIKey | IHZLWCGRXUTVEY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |