C24H24N4O2S2 — CID 2491762
4-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-2-thiophen-2-ylquinazoline (PubChem CID 2491762) has the molecular formula C24H24N4O2S2 and a molecular weight of 464.62 g/mol. Its IUPAC name is 4-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-2-thiophen-2-ylquinazoline.
| Compound Name | 4-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-2-thiophen-2-ylquinazoline |
|---|---|
| PubChem CID | 2491762 |
| Molecular Formula | C24H24N4O2S2 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 4-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-2-thiophen-2-ylquinazoline |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCN(c3nc(-c4cccs4)nc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C24H24N4O2S2/c1-17-9-10-18(2)22(16-17)32(29,30)28-13-11-27(12-14-28)24-19-6-3-4-7-20(19)25-23(26-24)21-8-5-15-31-21/h3-10,15-16H,11-14H2,1-2H3 |
| InChIKey | AOBDJYZWKQKVPE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |