C27H29N5O2S — CID 55515853
4-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-2-pyridin-4-ylquinazoline (PubChem CID 55515853) has the molecular formula C27H29N5O2S and a molecular weight of 487.63 g/mol. Its IUPAC name is 4-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-2-pyridin-4-ylquinazoline.
| Compound Name | 4-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-2-pyridin-4-ylquinazoline |
|---|---|
| PubChem CID | 55515853 |
| Molecular Formula | C27H29N5O2S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 4-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-2-pyridin-4-ylquinazoline |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCN(c3nc(-c4ccncc4)nc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C27H29N5O2S/c1-27(2,3)21-8-10-22(11-9-21)35(33,34)32-18-16-31(17-19-32)26-23-6-4-5-7-24(23)29-25(30-26)20-12-14-28-15-13-20/h4-15H,16-19H2,1-3H3 |
| InChIKey | CLVPWEZRHCNPBX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |