C24H20Cl2N4O2S — CID 46133835
7-chloro-4-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-phenylquinazoline (PubChem CID 46133835) has the molecular formula C24H20Cl2N4O2S and a molecular weight of 499.42 g/mol. Its IUPAC name is 7-chloro-4-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-phenylquinazoline.
| Compound Name | 7-chloro-4-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-phenylquinazoline |
|---|---|
| PubChem CID | 46133835 |
| Molecular Formula | C24H20Cl2N4O2S |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 7-chloro-4-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-phenylquinazoline |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCN(c2nc(-c3ccccc3)nc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C24H20Cl2N4O2S/c25-18-6-9-20(10-7-18)33(31,32)30-14-12-29(13-15-30)24-21-11-8-19(26)16-22(21)27-23(28-24)17-4-2-1-3-5-17/h1-11,16H,12-15H2 |
| InChIKey | GMCPMHJLSOGEKF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |