C20H18F4N4O2S — CID 53052264
2-[4-(5-fluoro-2-methylphenyl)sulfonylpiperazin-1-yl]-3-(trifluoromethyl)quinoxaline (PubChem CID 53052264) has the molecular formula C20H18F4N4O2S and a molecular weight of 454.45 g/mol. Its IUPAC name is 2-[4-(5-fluoro-2-methylphenyl)sulfonylpiperazin-1-yl]-3-(trifluoromethyl)quinoxaline.
| Compound Name | 2-[4-(5-fluoro-2-methylphenyl)sulfonylpiperazin-1-yl]-3-(trifluoromethyl)quinoxaline |
|---|---|
| PubChem CID | 53052264 |
| Molecular Formula | C20H18F4N4O2S |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 2-[4-(5-fluoro-2-methylphenyl)sulfonylpiperazin-1-yl]-3-(trifluoromethyl)quinoxaline |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)N1CCN(c2nc3ccccc3nc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H18F4N4O2S/c1-13-6-7-14(21)12-17(13)31(29,30)28-10-8-27(9-11-28)19-18(20(22,23)24)25-15-4-2-3-5-16(15)26-19/h2-7,12H,8-11H2,1H3 |
| InChIKey | CIVHOVGMUHPLFH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |