C17H21NO2S2 — CID 90522191
1-(2,5-dimethylphenyl)sulfonyl-4-thiophen-2-ylpiperidine (PubChem CID 90522191) has the molecular formula C17H21NO2S2 and a molecular weight of 335.49 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)sulfonyl-4-thiophen-2-ylpiperidine.
| Compound Name | 1-(2,5-dimethylphenyl)sulfonyl-4-thiophen-2-ylpiperidine |
|---|---|
| PubChem CID | 90522191 |
| Molecular Formula | C17H21NO2S2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1-(2,5-dimethylphenyl)sulfonyl-4-thiophen-2-ylpiperidine |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCC(c3cccs3)CC2)c1 |
| InChI | InChI=1S/C17H21NO2S2/c1-13-5-6-14(2)17(12-13)22(19,20)18-9-7-15(8-10-18)16-4-3-11-21-16/h3-6,11-12,15H,7-10H2,1-2H3 |
| InChIKey | DJGWIEDQKNEVJD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |