C16H21N3O2S — CID 110871203
1-(2,5-dimethylphenyl)sulfonyl-4-pyrazol-1-ylpiperidine (PubChem CID 110871203) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)sulfonyl-4-pyrazol-1-ylpiperidine.
| Compound Name | 1-(2,5-dimethylphenyl)sulfonyl-4-pyrazol-1-ylpiperidine |
|---|---|
| PubChem CID | 110871203 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-(2,5-dimethylphenyl)sulfonyl-4-pyrazol-1-ylpiperidine |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCC(n3cccn3)CC2)c1 |
| InChI | InChI=1S/C16H21N3O2S/c1-13-4-5-14(2)16(12-13)22(20,21)18-10-6-15(7-11-18)19-9-3-8-17-19/h3-5,8-9,12,15H,6-7,10-11H2,1-2H3 |
| InChIKey | JJTYSLWZINAYRI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |