C22H30N4O2S — CID 78835231
2-[4-[2-(benzylamino)-2-oxoethyl]piperazin-1-yl]-N-(2-thiophen-2-ylethyl)propanamide (PubChem CID 78835231) has the molecular formula C22H30N4O2S and a molecular weight of 414.58 g/mol. Its IUPAC name is 2-[4-[2-(benzylamino)-2-oxoethyl]piperazin-1-yl]-N-(2-thiophen-2-ylethyl)propanamide.
| Compound Name | 2-[4-[2-(benzylamino)-2-oxoethyl]piperazin-1-yl]-N-(2-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 78835231 |
| Molecular Formula | C22H30N4O2S |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 2-[4-[2-(benzylamino)-2-oxoethyl]piperazin-1-yl]-N-(2-thiophen-2-ylethyl)propanamide |
| SMILES | CC(C(=O)NCCc1cccs1)N1CCN(CC(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H30N4O2S/c1-18(22(28)23-10-9-20-8-5-15-29-20)26-13-11-25(12-14-26)17-21(27)24-16-19-6-3-2-4-7-19/h2-8,15,18H,9-14,16-17H2,1H3,(H,23,28)(H,24,27) |
| InChIKey | UYGADFJGSQKDQL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |