C23H28ClNO2 — CID 138553761
N-(4-chlorophenyl)-2-[4-[(3-methylphenyl)methoxy]cyclohexyl]propanamide (PubChem CID 138553761) has the molecular formula C23H28ClNO2 and a molecular weight of 385.94 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[4-[(3-methylphenyl)methoxy]cyclohexyl]propanamide.
| Compound Name | N-(4-chlorophenyl)-2-[4-[(3-methylphenyl)methoxy]cyclohexyl]propanamide |
|---|---|
| PubChem CID | 138553761 |
| Molecular Formula | C23H28ClNO2 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-(4-chlorophenyl)-2-[4-[(3-methylphenyl)methoxy]cyclohexyl]propanamide |
| SMILES | Cc1cccc(COC2CCC(C(C)C(=O)Nc3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C23H28ClNO2/c1-16-4-3-5-18(14-16)15-27-22-12-6-19(7-13-22)17(2)23(26)25-21-10-8-20(24)9-11-21/h3-5,8-11,14,17,19,22H,6-7,12-13,15H2,1-2H3,(H,25,26) |
| InChIKey | WHNQSMJPONTLIO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |