C24H37NO2 — CID 138553616
N-(1-methylcyclohexyl)-2-[4-[(3-methylphenyl)methoxy]cyclohexyl]propanamide (PubChem CID 138553616) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is N-(1-methylcyclohexyl)-2-[4-[(3-methylphenyl)methoxy]cyclohexyl]propanamide.
| Compound Name | N-(1-methylcyclohexyl)-2-[4-[(3-methylphenyl)methoxy]cyclohexyl]propanamide |
|---|---|
| PubChem CID | 138553616 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | N-(1-methylcyclohexyl)-2-[4-[(3-methylphenyl)methoxy]cyclohexyl]propanamide |
| SMILES | Cc1cccc(COC2CCC(C(C)C(=O)NC3(C)CCCCC3)CC2)c1 |
| InChI | InChI=1S/C24H37NO2/c1-18-8-7-9-20(16-18)17-27-22-12-10-21(11-13-22)19(2)23(26)25-24(3)14-5-4-6-15-24/h7-9,16,19,21-22H,4-6,10-15,17H2,1-3H3,(H,25,26) |
| InChIKey | OVRIOILYVOTQAC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |