C24H22ClFN2O — CID 134823837
(2R)-N-(4-chlorophenyl)-2-[(1R,4R)-4-(6-fluoroquinolin-4-yl)cyclohex-2-en-1-yl]propanamide (PubChem CID 134823837) has the molecular formula C24H22ClFN2O and a molecular weight of 408.90 g/mol. Its IUPAC name is (2R)-N-(4-chlorophenyl)-2-[(1R,4R)-4-(6-fluoroquinolin-4-yl)cyclohex-2-en-1-yl]propanamide.
| Compound Name | (2R)-N-(4-chlorophenyl)-2-[(1R,4R)-4-(6-fluoroquinolin-4-yl)cyclohex-2-en-1-yl]propanamide |
|---|---|
| PubChem CID | 134823837 |
| Molecular Formula | C24H22ClFN2O |
| Molecular Weight | 408.90 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (2R)-N-(4-chlorophenyl)-2-[(1R,4R)-4-(6-fluoroquinolin-4-yl)cyclohex-2-en-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(Cl)cc1)[C@H]1C=C[C@H](c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C24H22ClFN2O/c1-15(24(29)28-20-9-6-18(25)7-10-20)16-2-4-17(5-3-16)21-12-13-27-23-11-8-19(26)14-22(21)23/h2,4,6-17H,3,5H2,1H3,(H,28,29)/t15-,16+,17+/m1/s1 |
| InChIKey | CSBJLAIQPLASNX-IKGGRYGDSA-N |
| XLogP | 6.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.90 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|