C24H23ClFN3O2 — CID 139295372
N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)-3,3-dimethylpiperidin-1-yl]-2-oxoacetamide (PubChem CID 139295372) has the molecular formula C24H23ClFN3O2 and a molecular weight of 439.92 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)-3,3-dimethylpiperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)-3,3-dimethylpiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 139295372 |
| Molecular Formula | C24H23ClFN3O2 |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)-3,3-dimethylpiperidin-1-yl]-2-oxoacetamide |
| SMILES | CC1(C)CN(C(=O)C(=O)Nc2ccc(Cl)cc2)CCC1c1ccnc2ccc(F)cc12 |
| InChI | InChI=1S/C24H23ClFN3O2/c1-24(2)14-29(23(31)22(30)28-17-6-3-15(25)4-7-17)12-10-20(24)18-9-11-27-21-8-5-16(26)13-19(18)21/h3-9,11,13,20H,10,12,14H2,1-2H3,(H,28,30) |
| InChIKey | KLBRJGLBPSMKQT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|