C26H24ClFN2O — CID 147463331
2-[(3aS,5S,6aS)-5-(6-fluoroquinolin-4-yl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-(4-chlorophenyl)propanamide (PubChem CID 147463331) has the molecular formula C26H24ClFN2O and a molecular weight of 434.94 g/mol. Its IUPAC name is 2-[(3aS,5S,6aS)-5-(6-fluoroquinolin-4-yl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-(4-chlorophenyl)propanamide.
| Compound Name | 2-[(3aS,5S,6aS)-5-(6-fluoroquinolin-4-yl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-(4-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 147463331 |
| Molecular Formula | C26H24ClFN2O |
| Molecular Weight | 434.94 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-[(3aS,5S,6aS)-5-(6-fluoroquinolin-4-yl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-(4-chlorophenyl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(Cl)cc1)C1=C[C@H]2C[C@@H](c3ccnc4ccc(F)cc34)C[C@H]2C1 |
| InChI | InChI=1S/C26H24ClFN2O/c1-15(26(31)30-22-5-2-20(27)3-6-22)16-10-17-12-19(13-18(17)11-16)23-8-9-29-25-7-4-21(28)14-24(23)25/h2-10,14-15,17-19H,11-13H2,1H3,(H,30,31)/t15?,17-,18+,19+/m0/s1 |
| InChIKey | FAILPGNKWNXCTE-GZWWCELFSA-N |
| XLogP | 6.74 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.94 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|