C13H16INO3S — CID 9047493
2-[(3S)-1,1-dioxothiolan-3-yl]-N-(3-iodo-4-methylphenyl)acetamide (PubChem CID 9047493) has the molecular formula C13H16INO3S and a molecular weight of 393.25 g/mol. Its IUPAC name is 2-[(3S)-1,1-dioxothiolan-3-yl]-N-(3-iodo-4-methylphenyl)acetamide.
| Compound Name | 2-[(3S)-1,1-dioxothiolan-3-yl]-N-(3-iodo-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 9047493 |
| Molecular Formula | C13H16INO3S |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | 2-[(3S)-1,1-dioxothiolan-3-yl]-N-(3-iodo-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)C[C@H]2CCS(=O)(=O)C2)cc1I |
| InChI | InChI=1S/C13H16INO3S/c1-9-2-3-11(7-12(9)14)15-13(16)6-10-4-5-19(17,18)8-10/h2-3,7,10H,4-6,8H2,1H3,(H,15,16)/t10-/m1/s1 |
| InChIKey | YCGNUIMCUNLBLR-SNVBAGLBSA-N |
| XLogP | 2.36 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|