C17H23ClN2O5S — CID 1489954
(2S)-2-(4-chloro-3,5-dimethylphenoxy)-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]propanehydrazide (PubChem CID 1489954) has the molecular formula C17H23ClN2O5S and a molecular weight of 402.90 g/mol. Its IUPAC name is (2S)-2-(4-chloro-3,5-dimethylphenoxy)-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]propanehydrazide.
| Compound Name | (2S)-2-(4-chloro-3,5-dimethylphenoxy)-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]propanehydrazide |
|---|---|
| PubChem CID | 1489954 |
| Molecular Formula | C17H23ClN2O5S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | (2S)-2-(4-chloro-3,5-dimethylphenoxy)-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]propanehydrazide |
| SMILES | Cc1cc(O[C@@H](C)C(=O)NNC(=O)C[C@@H]2CCS(=O)(=O)C2)cc(C)c1Cl |
| InChI | InChI=1S/C17H23ClN2O5S/c1-10-6-14(7-11(2)16(10)18)25-12(3)17(22)20-19-15(21)8-13-4-5-26(23,24)9-13/h6-7,12-13H,4-5,8-9H2,1-3H3,(H,19,21)(H,20,22)/t12-,13-/m0/s1 |
| InChIKey | KNZHMOPXPZKHAK-STQMWFEESA-N |
| XLogP | 1.70 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|