C17H21FN2O7S — CID 8936297
[2-[2-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]hydrazinyl]-2-oxoethyl] (2R)-2-(4-fluorophenoxy)propanoate (PubChem CID 8936297) has the molecular formula C17H21FN2O7S and a molecular weight of 416.43 g/mol. Its IUPAC name is [2-[2-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]hydrazinyl]-2-oxoethyl] (2R)-2-(4-fluorophenoxy)propanoate.
| Compound Name | [2-[2-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]hydrazinyl]-2-oxoethyl] (2R)-2-(4-fluorophenoxy)propanoate |
|---|---|
| PubChem CID | 8936297 |
| Molecular Formula | C17H21FN2O7S |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | [2-[2-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]hydrazinyl]-2-oxoethyl] (2R)-2-(4-fluorophenoxy)propanoate |
| SMILES | C[C@@H](Oc1ccc(F)cc1)C(=O)OCC(=O)NNC(=O)C[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H21FN2O7S/c1-11(27-14-4-2-13(18)3-5-14)17(23)26-9-16(22)20-19-15(21)8-12-6-7-28(24,25)10-12/h2-5,11-12H,6-10H2,1H3,(H,19,21)(H,20,22)/t11-,12+/m1/s1 |
| InChIKey | NHEKHSFLOZBSIL-NEPJUHHUSA-N |
| XLogP | 0.11 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|