C17H17FN2O4S2 — CID 55408907
N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-5-(4-fluorophenyl)thiophene-2-carbohydrazide (PubChem CID 55408907) has the molecular formula C17H17FN2O4S2 and a molecular weight of 396.47 g/mol. Its IUPAC name is N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-5-(4-fluorophenyl)thiophene-2-carbohydrazide.
| Compound Name | N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-5-(4-fluorophenyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 55408907 |
| Molecular Formula | C17H17FN2O4S2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-5-(4-fluorophenyl)thiophene-2-carbohydrazide |
| SMILES | O=C(CC1CCS(=O)(=O)C1)NNC(=O)c1ccc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C17H17FN2O4S2/c18-13-3-1-12(2-4-13)14-5-6-15(25-14)17(22)20-19-16(21)9-11-7-8-26(23,24)10-11/h1-6,11H,7-10H2,(H,19,21)(H,20,22) |
| InChIKey | GURUCWUWVFLEHE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|