C16H17BrN4O4S — CID 55463127
3-(4-bromophenyl)-N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-1H-pyrazole-5-carbohydrazide (PubChem CID 55463127) has the molecular formula C16H17BrN4O4S and a molecular weight of 441.31 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-1H-pyrazole-5-carbohydrazide.
| Compound Name | 3-(4-bromophenyl)-N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 55463127 |
| Molecular Formula | C16H17BrN4O4S |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | 3-(4-bromophenyl)-N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(CC1CCS(=O)(=O)C1)NNC(=O)c1cc(-c2ccc(Br)cc2)n[nH]1 |
| InChI | InChI=1S/C16H17BrN4O4S/c17-12-3-1-11(2-4-12)13-8-14(19-18-13)16(23)21-20-15(22)7-10-5-6-26(24,25)9-10/h1-4,8,10H,5-7,9H2,(H,18,19)(H,20,22)(H,21,23) |
| InChIKey | ZYCMMPUJTLVUNC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|