C13H16BrN3O3S2 — CID 9238322
1-(3-bromophenyl)-3-[[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]amino]thiourea (PubChem CID 9238322) has the molecular formula C13H16BrN3O3S2 and a molecular weight of 406.33 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]amino]thiourea.
| Compound Name | 1-(3-bromophenyl)-3-[[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 9238322 |
| Molecular Formula | C13H16BrN3O3S2 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 1-(3-bromophenyl)-3-[[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]amino]thiourea |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)NNC(=S)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C13H16BrN3O3S2/c14-10-2-1-3-11(7-10)15-13(21)17-16-12(18)6-9-4-5-22(19,20)8-9/h1-3,7,9H,4-6,8H2,(H,16,18)(H2,15,17,21)/t9-/m0/s1 |
| InChIKey | FSHVAEYBYBRVRY-VIFPVBQESA-N |
| XLogP | 1.59 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|