C20H22FN3O3 — CID 35187050
N-[3-[[[2-(4-fluorophenyl)acetyl]amino]carbamoyl]phenyl]-2,2-dimethylpropanamide (PubChem CID 35187050) has the molecular formula C20H22FN3O3 and a molecular weight of 371.41 g/mol. Its IUPAC name is N-[3-[[[2-(4-fluorophenyl)acetyl]amino]carbamoyl]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[[[2-(4-fluorophenyl)acetyl]amino]carbamoyl]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 35187050 |
| Molecular Formula | C20H22FN3O3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-[3-[[[2-(4-fluorophenyl)acetyl]amino]carbamoyl]phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(C(=O)NNC(=O)Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H22FN3O3/c1-20(2,3)19(27)22-16-6-4-5-14(12-16)18(26)24-23-17(25)11-13-7-9-15(21)10-8-13/h4-10,12H,11H2,1-3H3,(H,22,27)(H,23,25)(H,24,26) |
| InChIKey | MSOBGAYKNGXQAY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|