C16H20N2O2 — CID 98435271
2-[[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]benzamide (PubChem CID 98435271) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]benzamide.
| Compound Name | 2-[[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 98435271 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2-[[2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)C[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C16H20N2O2/c17-16(20)13-3-1-2-4-14(13)18-15(19)9-12-8-10-5-6-11(12)7-10/h1-4,10-12H,5-9H2,(H2,17,20)(H,18,19)/t10-,11-,12+/m0/s1 |
| InChIKey | SHTFVMIEMVYFCF-SDDRHHMPSA-N |
| XLogP | 2.55 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |