C15H19FN2O — CID 63256940
N-(2-amino-5-fluorophenyl)-2-(2-bicyclo[2.2.1]heptanyl)acetamide (PubChem CID 63256940) has the molecular formula C15H19FN2O and a molecular weight of 262.33 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-2-(2-bicyclo[2.2.1]heptanyl)acetamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-2-(2-bicyclo[2.2.1]heptanyl)acetamide |
|---|---|
| PubChem CID | 63256940 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-2-(2-bicyclo[2.2.1]heptanyl)acetamide |
| SMILES | Nc1ccc(F)cc1NC(=O)CC1CC2CCC1C2 |
| InChI | InChI=1S/C15H19FN2O/c16-12-3-4-13(17)14(8-12)18-15(19)7-11-6-9-1-2-10(11)5-9/h3-4,8-11H,1-2,5-7,17H2,(H,18,19) |
| InChIKey | HSQLJNONRLTMSQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|