C27H37NO6Si2 — CID 11329981
5-[2-methyl-4,5-bis(trimethylsilyl)phenoxy]-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide (PubChem CID 11329981) has the molecular formula C27H37NO6Si2 and a molecular weight of 527.77 g/mol. Its IUPAC name is 5-[2-methyl-4,5-bis(trimethylsilyl)phenoxy]-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide.
| Compound Name | 5-[2-methyl-4,5-bis(trimethylsilyl)phenoxy]-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 11329981 |
| Molecular Formula | C27H37NO6Si2 |
| Molecular Weight | 527.77 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 5-[2-methyl-4,5-bis(trimethylsilyl)phenoxy]-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)c2ccc(Oc3cc([Si](C)(C)C)c([Si](C)(C)C)cc3C)o2)c(OC)c1 |
| InChI | InChI=1S/C27H37NO6Si2/c1-17-13-23(35(5,6)7)24(36(8,9)10)16-20(17)34-25-12-11-19(33-25)27(29)28-26-21(31-3)14-18(30-2)15-22(26)32-4/h11-16H,1-10H3,(H,28,29) |
| InChIKey | CEBSMZDZWWCYHR-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.77 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|